2-hydroxy-3-chlorobenzoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

3-chlorosalicylic acid; 2-hydroxy-3-chlorobenzoic acid
CAS RN:[1829-32-9]
Formula:C7H5ClO3; 172.57 g/mol
InChiKey:PPINMMULCRBDOS-UHFFFAOYSA-N
SMILES:OC(=O)c1cccc(Cl)c1O
Molecular structure of 2-hydroxy-3-chlorobenzoic acid
Melting point:185 °C

Isomers

2-chloro-5-hydroxybenzoic acid
Molecular structure of 2-chloro-5-hydroxybenzoic acid
3-chloro-4-hydroxybenzoic acid
Molecular structure of 3-chloro-4-hydroxybenzoic acid
4-chloro-2-hydroxybenzoic acid
Molecular structure of 4-chloro-2-hydroxybenzoic acid
5-chloro-2-hydroxybenzoic acid
Molecular structure of 5-chloro-2-hydroxybenzoic acid
3-chloroperoxybenzoic acid
Molecular structure of 3-chloroperoxybenzoic acid
2-hydroxy-3-chlorobenzoic acid
Molecular structure of 2-hydroxy-3-chlorobenzoic acid
  ::